C22H31NO2 — CID 67523059
(8R,9S,13S,14S,15R)-15-(3-aminopropyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 67523059) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (8R,9S,13S,14S,15R)-15-(3-aminopropyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S,15R)-15-(3-aminopropyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 67523059 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (8R,9S,13S,14S,15R)-15-(3-aminopropyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COc1ccc2c(c1)CC[C@H]1[C@@H]3[C@H](CCCN)CC(=O)[C@@]3(C)CC[C@H]21 |
| InChI | InChI=1S/C22H31NO2/c1-22-10-9-18-17-8-6-16(25-2)12-14(17)5-7-19(18)21(22)15(4-3-11-23)13-20(22)24/h6,8,12,15,18-19,21H,3-5,7,9-11,13,23H2,1-2H3/t15-,18-,19-,21+,22-/m1/s1 |
| InChIKey | UEPRCGAWTZAIDU-DDJZRCTDSA-N |
| XLogP | 4.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |