C31H48O4 — CID 143047621
ethane;5-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)pentyl 2,2-dimethylpropanoate (PubChem CID 143047621) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is ethane;5-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)pentyl 2,2-dimethylpropanoate.
| Compound Name | ethane;5-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)pentyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 143047621 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | ethane;5-(3-methoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl)pentyl 2,2-dimethylpropanoate |
| SMILES | CC.COc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CC(CCCCCOC(=O)C(C)(C)C)C12 |
| InChI | InChI=1S/C29H42O4.C2H6/c1-28(2,3)27(31)33-16-8-6-7-9-20-18-25(30)29(4)15-14-23-22-13-11-21(32-5)17-19(22)10-12-24(23)26(20)29;1-2/h11,13,17,20,23-24,26H,6-10,12,14-16,18H2,1-5H3;1-2H3 |
| InChIKey | UAEXLQCXADSTBB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|