C29H34O4 — CID 143047695
4-[(8R,9S,13S,14S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoic acid (PubChem CID 143047695) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 4-[(8R,9S,13S,14S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoic acid.
| Compound Name | 4-[(8R,9S,13S,14S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoic acid |
|---|---|
| PubChem CID | 143047695 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 4-[(8R,9S,13S,14S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]butanoic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1C(CCCC(=O)O)CC2=O |
| InChI | InChI=1S/C29H34O4/c1-29-15-14-24-23-13-11-22(33-18-19-6-3-2-4-7-19)16-20(23)10-12-25(24)28(29)21(17-26(29)30)8-5-9-27(31)32/h2-4,6-7,11,13,16,21,24-25,28H,5,8-10,12,14-15,17-18H2,1H3,(H,31,32)/t21?,24-,25-,28+,29-/m1/s1 |
| InChIKey | SNHCDQCIXVPDRQ-MKBDELAZSA-N |
| XLogP | 6.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |