C30H34O4 — CID 66859249
methyl 4-[(13S,15S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]but-2-enoate (PubChem CID 66859249) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is methyl 4-[(13S,15S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]but-2-enoate.
| Compound Name | methyl 4-[(13S,15S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]but-2-enoate |
|---|---|
| PubChem CID | 66859249 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | methyl 4-[(13S,15S)-13-methyl-17-oxo-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]but-2-enoate |
| SMILES | COC(=O)C=CCC1CC(=O)[C@@]2(C)CCC3c4ccc(OCc5ccccc5)cc4CCC3C12 |
| InChI | InChI=1S/C30H34O4/c1-30-16-15-25-24-14-12-23(34-19-20-7-4-3-5-8-20)17-21(24)11-13-26(25)29(30)22(18-27(30)31)9-6-10-28(32)33-2/h3-8,10,12,14,17,22,25-26,29H,9,11,13,15-16,18-19H2,1-2H3/t22?,25?,26?,29?,30-/m1/s1 |
| InChIKey | FLTOULFIZINFPK-NSKKIWJKSA-N |
| XLogP | 6.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|