C27H30O3 — CID 58622091
1-[(13S)-17-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-yl]ethanone (PubChem CID 58622091) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is 1-[(13S)-17-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-yl]ethanone.
| Compound Name | 1-[(13S)-17-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-yl]ethanone |
|---|---|
| PubChem CID | 58622091 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-[(13S)-17-hydroxy-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-yl]ethanone |
| SMILES | CC(=O)C1=C(O)[C@@]2(C)CCC3c4ccc(OCc5ccccc5)cc4CCC3C2C1 |
| InChI | InChI=1S/C27H30O3/c1-17(28)24-15-25-23-10-8-19-14-20(30-16-18-6-4-3-5-7-18)9-11-21(19)22(23)12-13-27(25,2)26(24)29/h3-7,9,11,14,22-23,25,29H,8,10,12-13,15-16H2,1-2H3/t22?,23?,25?,27-/m0/s1 |
| InChIKey | YNLQEZJVLPSWRX-OGKQIOMYSA-N |
| XLogP | 6.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |