C30H36N2O — CID 11532271
(1R,2S,9S,12S)-9-methyl-6-(2-methylpropyl)-16-phenylmethoxy-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,7,13(18),14,16-pentaene (PubChem CID 11532271) has the molecular formula C30H36N2O and a molecular weight of 440.63 g/mol. Its IUPAC name is (1R,2S,9S,12S)-9-methyl-6-(2-methylpropyl)-16-phenylmethoxy-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,7,13(18),14,16-pentaene.
| Compound Name | (1R,2S,9S,12S)-9-methyl-6-(2-methylpropyl)-16-phenylmethoxy-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,7,13(18),14,16-pentaene |
|---|---|
| PubChem CID | 11532271 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (1R,2S,9S,12S)-9-methyl-6-(2-methylpropyl)-16-phenylmethoxy-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4,7,13(18),14,16-pentaene |
| SMILES | CC(C)Cn1cc2c(n1)[C@@]1(C)CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1C2 |
| InChI | InChI=1S/C30H36N2O/c1-20(2)17-32-18-23-16-28-27-11-9-22-15-24(33-19-21-7-5-4-6-8-21)10-12-25(22)26(27)13-14-30(28,3)29(23)31-32/h4-8,10,12,15,18,20,26-28H,9,11,13-14,16-17,19H2,1-3H3/t26-,27-,28+,30+/m1/s1 |
| InChIKey | MFWSTIMGPFVGGM-LWFIHPCQSA-N |
| XLogP | 6.69 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |