C25H31NO4S — CID 87396758
[(8R,9S,13S,14S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate (PubChem CID 87396758) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate.
| Compound Name | [(8R,9S,13S,14S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate |
|---|---|
| PubChem CID | 87396758 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | [(8R,9S,13S,14S,17R)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1CC[C@H]2OS(N)(=O)=O |
| InChI | InChI=1S/C25H31NO4S/c1-25-14-13-21-20-10-8-19(29-16-17-5-3-2-4-6-17)15-18(20)7-9-22(21)23(25)11-12-24(25)30-31(26,27)28/h2-6,8,10,15,21-24H,7,9,11-14,16H2,1H3,(H2,26,27,28)/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | ZVRJYNHYHOXJGC-RXFVIIJJSA-N |
| XLogP | 4.71 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |