C31H36F6O3 — CID 137465529
(8R,9S,13S,14S)-17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 137465529) has the molecular formula C31H36F6O3 and a molecular weight of 570.61 g/mol. Its IUPAC name is (8R,9S,13S,14S)-17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,13S,14S)-17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 137465529 |
| Molecular Formula | C31H36F6O3 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | (8R,9S,13S,14S)-17-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propoxy]-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1CCC2OCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C31H36F6O3/c1-29-15-14-24-23-11-9-22(40-19-20-6-3-2-4-7-20)18-21(23)8-10-25(24)26(29)12-13-27(29)38-16-5-17-39-28(30(32,33)34)31(35,36)37/h2-4,6-7,9,11,18,24-28H,5,8,10,12-17,19H2,1H3/t24-,25-,26+,27?,29+/m1/s1 |
| InChIKey | RUNUVZJKWWEJMX-AFZZLIEPSA-N |
| XLogP | 8.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|