C38H64O3 — CID 140901290
17-[3-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)oxypropoxy]-3-(4-deuteriobutoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 140901290) has the molecular formula C38H64O3 and a molecular weight of 569.93 g/mol. Its IUPAC name is 17-[3-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)oxypropoxy]-3-(4-deuteriobutoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | 17-[3-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)oxypropoxy]-3-(4-deuteriobutoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 140901290 |
| Molecular Formula | C38H64O3 |
| Molecular Weight | 569.93 g/mol |
| Exact Mass | 569.49 |
| IUPAC Name | 17-[3-(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl)oxypropoxy]-3-(4-deuteriobutoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | [2H]CCCCOc1ccc2c(c1)CCC1C2CCC2(C)C(OCCCOC(C(C)(C)C)(C(C)(C)C)C(C)(C)C)CCC12 |
| InChI | InChI=1S/C38H64O3/c1-12-13-23-39-28-16-18-29-27(26-28)15-17-31-30(29)21-22-37(11)32(31)19-20-33(37)40-24-14-25-41-38(34(2,3)4,35(5,6)7)36(8,9)10/h16,18,26,30-33H,12-15,17,19-25H2,1-11H3/i1D |
| InChIKey | ZXNDUBFIEDZMCQ-MICDWDOJSA-N |
| XLogP | 10.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.93 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|