C30H43F6NO3S — CID 162621023
3-[2-[[17-[3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxypropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]ethylamino]propane-1-thiol (PubChem CID 162621023) has the molecular formula C30H43F6NO3S and a molecular weight of 611.73 g/mol. Its IUPAC name is 3-[2-[[17-[3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxypropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]ethylamino]propane-1-thiol.
| Compound Name | 3-[2-[[17-[3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxypropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]ethylamino]propane-1-thiol |
|---|---|
| PubChem CID | 162621023 |
| Molecular Formula | C30H43F6NO3S |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 3-[2-[[17-[3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxypropoxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]ethylamino]propane-1-thiol |
| SMILES | CC12CCC3c4ccc(OCCNCCCS)cc4CCC3C1CCC2OCCCOC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C30H43F6NO3S/c1-27-12-11-23-22-8-6-21(38-17-14-37-13-3-18-41)19-20(22)5-7-24(23)25(27)9-10-26(27)39-15-4-16-40-28(2,29(31,32)33)30(34,35)36/h6,8,19,23-26,37,41H,3-5,7,9-18H2,1-2H3 |
| InChIKey | DTVPIPIRMJZPQD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|