C30H48O6 — CID 142613696
ethane;methyl 2-[4-[[17-(3-hydroxypropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]butoxy]acetate (PubChem CID 142613696) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is ethane;methyl 2-[4-[[17-(3-hydroxypropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]butoxy]acetate.
| Compound Name | ethane;methyl 2-[4-[[17-(3-hydroxypropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]butoxy]acetate |
|---|---|
| PubChem CID | 142613696 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | ethane;methyl 2-[4-[[17-(3-hydroxypropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]butoxy]acetate |
| SMILES | CC.COC(=O)COCCCCOc1ccc2c(c1)CCC1C2CCC2(C)C(OCCCO)CCC12 |
| InChI | InChI=1S/C28H42O6.C2H6/c1-28-13-12-23-22-9-7-21(33-16-4-3-15-32-19-27(30)31-2)18-20(22)6-8-24(23)25(28)10-11-26(28)34-17-5-14-29;1-2/h7,9,18,23-26,29H,3-6,8,10-17,19H2,1-2H3;1-2H3 |
| InChIKey | WLBIQVZREMHDKY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|