C28H34O4 — CID 89047880
[(13S,17S)-17-(3-hydroxypropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 89047880) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is [(13S,17S)-17-(3-hydroxypropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(13S,17S)-17-(3-hydroxypropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 89047880 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | [(13S,17S)-17-(3-hydroxypropoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@]12CCC3c4ccc(OC(=O)c5ccccc5)cc4CCC3C1CC[C@@H]2OCCCO |
| InChI | InChI=1S/C28H34O4/c1-28-15-14-23-22-11-9-21(32-27(30)19-6-3-2-4-7-19)18-20(22)8-10-24(23)25(28)12-13-26(28)31-17-5-16-29/h2-4,6-7,9,11,18,23-26,29H,5,8,10,12-17H2,1H3/t23?,24?,25?,26-,28-/m0/s1 |
| InChIKey | VHVOVTWJFWCWJX-ASQPPMIUSA-N |
| XLogP | 5.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|