C28H37NO4P2 — CID 143541942
3-[(3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)phosphanyl]propoxyphosphonamidous acid (PubChem CID 143541942) has the molecular formula C28H37NO4P2 and a molecular weight of 513.56 g/mol. Its IUPAC name is 3-[(3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)phosphanyl]propoxyphosphonamidous acid.
| Compound Name | 3-[(3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)phosphanyl]propoxyphosphonamidous acid |
|---|---|
| PubChem CID | 143541942 |
| Molecular Formula | C28H37NO4P2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 3-[(3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)phosphanyl]propoxyphosphonamidous acid |
| SMILES | CC12CCC3c4ccc(OC(=O)c5ccccc5)cc4CCC3C1CCC2PCCCOP(N)O |
| InChI | InChI=1S/C28H37NO4P2/c1-28-15-14-23-22-11-9-21(33-27(30)19-6-3-2-4-7-19)18-20(22)8-10-24(23)25(28)12-13-26(28)34-17-5-16-32-35(29)31/h2-4,6-7,9,11,18,23-26,31,34H,5,8,10,12-17,29H2,1H3 |
| InChIKey | LAZCULQBHQLSBM-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|