C27H30O4 — CID 46195611
[(13S,17R)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 46195611) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(13S,17R)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(13S,17R)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 46195611 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(13S,17R)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1CCC2C3CCc4cc(OC(=O)c5ccccc5)ccc4C3CC[C@@]21C |
| InChI | InChI=1S/C27H30O4/c1-17(28)30-25-13-12-24-23-10-8-19-16-20(31-26(29)18-6-4-3-5-7-18)9-11-21(19)22(23)14-15-27(24,25)2/h3-7,9,11,16,22-25H,8,10,12-15H2,1-2H3/t22?,23?,24?,25-,27+/m1/s1 |
| InChIKey | CRJBVQYNQZNAOQ-YLAQNYHASA-N |
| XLogP | 5.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|