C21H28O2 — CID 144967019
[(17S)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 144967019) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is [(17S)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(17S)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 144967019 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | [(17S)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC2C3CCc4cc(C)ccc4C3CCC21C |
| InChI | InChI=1S/C21H28O2/c1-13-4-6-16-15(12-13)5-7-18-17(16)10-11-21(3)19(18)8-9-20(21)23-14(2)22/h4,6,12,17-20H,5,7-11H2,1-3H3/t17?,18?,19?,20-,21?/m0/s1 |
| InChIKey | VIKYVPTXUHBIJM-KGMASTOKSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |