C23H32O3 — CID 66803080
[(6R,8R,9S,13S,14S)-6-(methoxymethyl)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 66803080) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is [(6R,8R,9S,13S,14S)-6-(methoxymethyl)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(6R,8R,9S,13S,14S)-6-(methoxymethyl)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 66803080 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [(6R,8R,9S,13S,14S)-6-(methoxymethyl)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COC[C@@H]1C[C@@H]2[C@H](CC[C@]3(C)C(OC(C)=O)CC[C@@H]23)c2ccc(C)cc21 |
| InChI | InChI=1S/C23H32O3/c1-14-5-6-17-18-9-10-23(3)21(7-8-22(23)26-15(2)24)20(18)12-16(13-25-4)19(17)11-14/h5-6,11,16,18,20-22H,7-10,12-13H2,1-4H3/t16-,18+,20+,21-,22?,23-/m0/s1 |
| InChIKey | QPVHSNGTEAUNRX-DSXLOISQSA-N |
| XLogP | 4.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |