C26H39BO2 — CID 143906805
[(9S)-6-(dimethylboranylmethyl)-13-methyl-3-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 143906805) has the molecular formula C26H39BO2 and a molecular weight of 394.41 g/mol. Its IUPAC name is [(9S)-6-(dimethylboranylmethyl)-13-methyl-3-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(9S)-6-(dimethylboranylmethyl)-13-methyl-3-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 143906805 |
| Molecular Formula | C26H39BO2 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | [(9S)-6-(dimethylboranylmethyl)-13-methyl-3-propyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CCCc1ccc2c(c1)C(CB(C)C)CC1C3CCC(OC(C)=O)C3(C)CC[C@H]21 |
| InChI | InChI=1S/C26H39BO2/c1-6-7-18-8-9-20-21-12-13-26(3)24(10-11-25(26)29-17(2)28)23(21)15-19(16-27(4)5)22(20)14-18/h8-9,14,19,21,23-25H,6-7,10-13,15-16H2,1-5H3/t19?,21-,23?,24?,25?,26?/m1/s1 |
| InChIKey | UNTPXHTUPWOKCM-PVQHWYDPSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|