C21H28O4 — CID 10315484
[(8R,9S,13S,14S,17S)-3-hydroxy-4-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 10315484) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-3-hydroxy-4-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,17S)-3-hydroxy-4-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 10315484 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-3-hydroxy-4-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COc1c(O)ccc2c1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H28O4/c1-12(22)25-19-9-7-17-15-4-5-16-13(6-8-18(23)20(16)24-3)14(15)10-11-21(17,19)2/h6,8,14-15,17,19,23H,4-5,7,9-11H2,1-3H3/t14-,15-,17+,19+,21+/m1/s1 |
| InChIKey | ICKAUPIZYPNQOT-QDOULVBYSA-N |
| XLogP | 4.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |