C33H40O7 — CID 101436248
[(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-2-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 101436248) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-2-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-2-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 101436248 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-3-methoxy-13-methyl-2-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COc1cc2c(cc1/C=C/C(=O)c1cc(OC)c(OC)c(OC)c1)[C@H]1CC[C@]3(C)[C@@H](OC(C)=O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C33H40O7/c1-19(34)40-31-12-10-26-24-9-7-20-16-28(36-3)21(15-25(20)23(24)13-14-33(26,31)2)8-11-27(35)22-17-29(37-4)32(39-6)30(18-22)38-5/h8,11,15-18,23-24,26,31H,7,9-10,12-14H2,1-6H3/b11-8+/t23-,24+,26-,31-,33-/m0/s1 |
| InChIKey | JDHUKMFVOCUTKD-WQNLGFIBSA-N |
| XLogP | 6.40 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|