C23H32O4S — CID 70654736
[(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-(methylsulfanylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 70654736) has the molecular formula C23H32O4S and a molecular weight of 404.57 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-(methylsulfanylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-(methylsulfanylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 70654736 |
| Molecular Formula | C23H32O4S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-(methylsulfanylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | COc1cc2c(cc1OCSC)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H32O4S/c1-14(24)27-22-8-7-19-17-6-5-15-11-21(26-13-28-4)20(25-3)12-18(15)16(17)9-10-23(19,22)2/h11-12,16-17,19,22H,5-10,13H2,1-4H3/t16-,17+,19-,22-,23-/m0/s1 |
| InChIKey | UIJUQCYQHDAVOY-JIAAILLZSA-N |
| XLogP | 5.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|