C24H35NO4 — CID 71167177
[(13S,17S)-3-butoxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbamate (PubChem CID 71167177) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is [(13S,17S)-3-butoxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbamate.
| Compound Name | [(13S,17S)-3-butoxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbamate |
|---|---|
| PubChem CID | 71167177 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | [(13S,17S)-3-butoxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbamate |
| SMILES | CCCCOc1cc2c(cc1OC)C1CC[C@@]3(C)C(CC[C@@H]3OC(N)=O)C1CC2 |
| InChI | InChI=1S/C24H35NO4/c1-4-5-12-28-21-13-15-6-7-17-16(18(15)14-20(21)27-3)10-11-24(2)19(17)8-9-22(24)29-23(25)26/h13-14,16-17,19,22H,4-12H2,1-3H3,(H2,25,26)/t16?,17?,19?,22-,24-/m0/s1 |
| InChIKey | PFQPXKPSHYEVAS-NXYNRMRQSA-N |
| XLogP | 5.19 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|