C20H29NO7S2 — CID 46196910
[(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] methanesulfonate (PubChem CID 46196910) has the molecular formula C20H29NO7S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] methanesulfonate.
| Compound Name | [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] methanesulfonate |
|---|---|
| PubChem CID | 46196910 |
| Molecular Formula | C20H29NO7S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] methanesulfonate |
| SMILES | COc1cc2c(cc1OS(N)(=O)=O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OS(C)(=O)=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H29NO7S2/c1-20-9-8-13-14(16(20)6-7-19(20)28-29(3,22)23)5-4-12-10-18(27-30(21,24)25)17(26-2)11-15(12)13/h10-11,13-14,16,19H,4-9H2,1-3H3,(H2,21,24,25)/t13-,14+,16-,19-,20-/m0/s1 |
| InChIKey | QMKODICWUNWEGC-BKRJIHRRSA-N |
| XLogP | 2.48 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|