C21H30N2O5S — CID 87218555
[(4bS,6aS,7E,10aS,10bR)-3-methoxy-7-methoxyimino-6a-methyl-4b,5,6,8,9,10,10a,10b,11,12-decahydrochrysen-2-yl] sulfamate (PubChem CID 87218555) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is [(4bS,6aS,7E,10aS,10bR)-3-methoxy-7-methoxyimino-6a-methyl-4b,5,6,8,9,10,10a,10b,11,12-decahydrochrysen-2-yl] sulfamate.
| Compound Name | [(4bS,6aS,7E,10aS,10bR)-3-methoxy-7-methoxyimino-6a-methyl-4b,5,6,8,9,10,10a,10b,11,12-decahydrochrysen-2-yl] sulfamate |
|---|---|
| PubChem CID | 87218555 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(4bS,6aS,7E,10aS,10bR)-3-methoxy-7-methoxyimino-6a-methyl-4b,5,6,8,9,10,10a,10b,11,12-decahydrochrysen-2-yl] sulfamate |
| SMILES | CO/N=C1\CCC[C@H]2[C@@H]3CCc4cc(OS(N)(=O)=O)c(OC)cc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H30N2O5S/c1-21-10-9-14-15(17(21)5-4-6-20(21)23-27-3)8-7-13-11-19(28-29(22,24)25)18(26-2)12-16(13)14/h11-12,14-15,17H,4-10H2,1-3H3,(H2,22,24,25)/b23-20+/t14-,15+,17-,21-/m0/s1 |
| InChIKey | ILVZVBHLPBGGSC-FSWCVVPHSA-N |
| XLogP | 3.53 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|