C20H28FNO4S — CID 10069396
[(6aS,7R)-7-fluoro-3-methoxy-6a-methyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate (PubChem CID 10069396) has the molecular formula C20H28FNO4S and a molecular weight of 397.51 g/mol. Its IUPAC name is [(6aS,7R)-7-fluoro-3-methoxy-6a-methyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate.
| Compound Name | [(6aS,7R)-7-fluoro-3-methoxy-6a-methyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate |
|---|---|
| PubChem CID | 10069396 |
| Molecular Formula | C20H28FNO4S |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [(6aS,7R)-7-fluoro-3-methoxy-6a-methyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate |
| SMILES | COc1cc2c(cc1OS(N)(=O)=O)CCC1C2CC[C@@]2(C)C1CCC[C@H]2F |
| InChI | InChI=1S/C20H28FNO4S/c1-20-9-8-13-14(16(20)4-3-5-19(20)21)7-6-12-10-18(26-27(22,23)24)17(25-2)11-15(12)13/h10-11,13-14,16,19H,3-9H2,1-2H3,(H2,22,23,24)/t13?,14?,16?,19-,20+/m1/s1 |
| InChIKey | KLCIBJYAAPKNCF-NYKFXILSSA-N |
| XLogP | 3.86 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |