C21H29NO4S — CID 16754953
[(13S,17Z)-17-ethylidene-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 16754953) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is [(13S,17Z)-17-ethylidene-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(13S,17Z)-17-ethylidene-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 16754953 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | [(13S,17Z)-17-ethylidene-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | C/C=C1/CCC2C3CCc4cc(OS(N)(=O)=O)c(OC)cc4C3CC[C@]12C |
| InChI | InChI=1S/C21H29NO4S/c1-4-14-6-8-18-16-7-5-13-11-20(26-27(22,23)24)19(25-3)12-17(13)15(16)9-10-21(14,18)2/h4,11-12,15-16,18H,5-10H2,1-3H3,(H2,22,23,24)/b14-4-/t15?,16?,18?,21-/m1/s1 |
| InChIKey | INMJTNNBMXTWQG-DNAQETHLSA-N |
| XLogP | 4.08 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|