C21H25F3O4S — CID 87336664
[(13S)-2-methoxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 87336664) has the molecular formula C21H25F3O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is [(13S)-2-methoxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [(13S)-2-methoxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87336664 |
| Molecular Formula | C21H25F3O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [(13S)-2-methoxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | C=C1CCC2C3CCc4cc(OS(=O)(=O)C(F)(F)F)c(OC)cc4C3CC[C@]12C |
| InChI | InChI=1S/C21H25F3O4S/c1-12-4-7-17-15-6-5-13-10-19(28-29(25,26)21(22,23)24)18(27-3)11-16(13)14(15)8-9-20(12,17)2/h10-11,14-15,17H,1,4-9H2,2-3H3/t14?,15?,17?,20-/m1/s1 |
| InChIKey | XLGKFIRYUUKJLX-IDQKJFIUSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|