C19H28N2O7S2 — CID 23646377
[(13S)-2-methoxy-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate (PubChem CID 23646377) has the molecular formula C19H28N2O7S2 and a molecular weight of 460.57 g/mol. Its IUPAC name is [(13S)-2-methoxy-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate.
| Compound Name | [(13S)-2-methoxy-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate |
|---|---|
| PubChem CID | 23646377 |
| Molecular Formula | C19H28N2O7S2 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [(13S)-2-methoxy-13-methyl-3-sulfamoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] sulfamate |
| SMILES | COc1cc2c(cc1OS(N)(=O)=O)CCC1C2CC[C@]2(C)C(OS(N)(=O)=O)CCC12 |
| InChI | InChI=1S/C19H28N2O7S2/c1-19-8-7-12-13(15(19)5-6-18(19)28-30(21,24)25)4-3-11-9-17(27-29(20,22)23)16(26-2)10-14(11)12/h9-10,12-13,15,18H,3-8H2,1-2H3,(H2,20,22,23)(H2,21,24,25)/t12?,13?,15?,18?,19-/m0/s1 |
| InChIKey | AQSNIXKAKUZPSI-VKYAZVNUSA-N |
| XLogP | 1.72 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |