C22H33NO5S — CID 66968840
[(4bS,6aS,10aS,10bR)-6a-ethyl-3,7-dimethoxy-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate (PubChem CID 66968840) has the molecular formula C22H33NO5S and a molecular weight of 423.58 g/mol. Its IUPAC name is [(4bS,6aS,10aS,10bR)-6a-ethyl-3,7-dimethoxy-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate.
| Compound Name | [(4bS,6aS,10aS,10bR)-6a-ethyl-3,7-dimethoxy-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate |
|---|---|
| PubChem CID | 66968840 |
| Molecular Formula | C22H33NO5S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | [(4bS,6aS,10aS,10bR)-6a-ethyl-3,7-dimethoxy-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-yl] sulfamate |
| SMILES | CC[C@]12CC[C@@H]3c4cc(OC)c(OS(N)(=O)=O)cc4CC[C@H]3[C@@H]1CCCC2OC |
| InChI | InChI=1S/C22H33NO5S/c1-4-22-11-10-15-16(18(22)6-5-7-21(22)27-3)9-8-14-12-20(28-29(23,24)25)19(26-2)13-17(14)15/h12-13,15-16,18,21H,4-11H2,1-3H3,(H2,23,24,25)/t15-,16+,18-,21?,22-/m0/s1 |
| InChIKey | JRIGZRFREOTMCY-IUNAXQSXSA-N |
| XLogP | 3.93 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |