C22H32O2 — CID 173141390
(4aS,4bR,10bS,12aS)-12a-ethyl-1,9-dimethoxy-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysene (PubChem CID 173141390) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (4aS,4bR,10bS,12aS)-12a-ethyl-1,9-dimethoxy-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysene.
| Compound Name | (4aS,4bR,10bS,12aS)-12a-ethyl-1,9-dimethoxy-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysene |
|---|---|
| PubChem CID | 173141390 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (4aS,4bR,10bS,12aS)-12a-ethyl-1,9-dimethoxy-2,3,4,4a,4b,5,6,10b,11,12-decahydro-1H-chrysene |
| SMILES | CC[C@]12CC[C@@H]3c4cc(OC)ccc4CC[C@H]3[C@@H]1CCCC2OC |
| InChI | InChI=1S/C22H32O2/c1-4-22-13-12-17-18(20(22)6-5-7-21(22)24-3)11-9-15-8-10-16(23-2)14-19(15)17/h8,10,14,17-18,20-21H,4-7,9,11-13H2,1-3H3/t17-,18+,20-,21?,22-/m0/s1 |
| InChIKey | QQXDCUSRNYTKTK-QTLBLUDQSA-N |
| XLogP | 5.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |