C20H26O2 — CID 173205600
(8R,9S,13S,17R)-13-ethyl-2-methoxy-6,7,8,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 173205600) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (8R,9S,13S,17R)-13-ethyl-2-methoxy-6,7,8,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,17R)-13-ethyl-2-methoxy-6,7,8,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 173205600 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (8R,9S,13S,17R)-13-ethyl-2-methoxy-6,7,8,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC[C@]12CC[C@@H]3c4cc(OC)ccc4CC[C@H]3C1=CC[C@H]2O |
| InChI | InChI=1S/C20H26O2/c1-3-20-11-10-15-16(18(20)8-9-19(20)21)7-5-13-4-6-14(22-2)12-17(13)15/h4,6,8,12,15-16,19,21H,3,5,7,9-11H2,1-2H3/t15-,16+,19+,20-/m0/s1 |
| InChIKey | CYUGZOVFHDIJEI-FIYPYCPBSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|