C15H20O — CID 134188965
6-methoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 134188965) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | 6-methoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 134188965 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 6-methoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | COc1ccc2c(c1)C1CCCCC1CC2 |
| InChI | InChI=1S/C15H20O/c1-16-13-9-8-12-7-6-11-4-2-3-5-14(11)15(12)10-13/h8-11,14H,2-7H2,1H3 |
| InChIKey | XQSRSXQTMJNPGO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |