C10H12OS — CID 79374496
6-methoxy-2,3-dihydro-1H-indene-1-thiol (PubChem CID 79374496) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is 6-methoxy-2,3-dihydro-1H-indene-1-thiol.
| Compound Name | 6-methoxy-2,3-dihydro-1H-indene-1-thiol |
|---|---|
| PubChem CID | 79374496 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-methoxy-2,3-dihydro-1H-indene-1-thiol |
| SMILES | COc1ccc2c(c1)C(S)CC2 |
| InChI | InChI=1S/C10H12OS/c1-11-8-4-2-7-3-5-10(12)9(7)6-8/h2,4,6,10,12H,3,5H2,1H3 |
| InChIKey | OZRXAVCYCZRMKI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|