C11H15NOS — CID 116995793
7-methoxy-2-methyl-3,4-dihydro-1H-isoquinoline-1-thiol (PubChem CID 116995793) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 7-methoxy-2-methyl-3,4-dihydro-1H-isoquinoline-1-thiol.
| Compound Name | 7-methoxy-2-methyl-3,4-dihydro-1H-isoquinoline-1-thiol |
|---|---|
| PubChem CID | 116995793 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 7-methoxy-2-methyl-3,4-dihydro-1H-isoquinoline-1-thiol |
| SMILES | COc1ccc2c(c1)C(S)N(C)CC2 |
| InChI | InChI=1S/C11H15NOS/c1-12-6-5-8-3-4-9(13-2)7-10(8)11(12)14/h3-4,7,11,14H,5-6H2,1-2H3 |
| InChIKey | HRVXTDAYJFHBJA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|