C10H13NS — CID 116995589
2-methyl-3,4-dihydro-1H-isoquinoline-1-thiol (PubChem CID 116995589) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-1H-isoquinoline-1-thiol.
| Compound Name | 2-methyl-3,4-dihydro-1H-isoquinoline-1-thiol |
|---|---|
| PubChem CID | 116995589 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-methyl-3,4-dihydro-1H-isoquinoline-1-thiol |
| SMILES | CN1CCc2ccccc2C1S |
| InChI | InChI=1S/C10H13NS/c1-11-7-6-8-4-2-3-5-9(8)10(11)12/h2-5,10,12H,6-7H2,1H3 |
| InChIKey | APTLCWVETXWEQC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|