C11H14ClN — CID 67824491
5-chloro-3-methyl-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 67824491) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is 5-chloro-3-methyl-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 5-chloro-3-methyl-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 67824491 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 5-chloro-3-methyl-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | CN1CCc2ccccc2C(Cl)C1 |
| InChI | InChI=1S/C11H14ClN/c1-13-7-6-9-4-2-3-5-10(9)11(12)8-13/h2-5,11H,6-8H2,1H3 |
| InChIKey | IHFNISWWRZPGDU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|