C14H20ClN — CID 45260521
(4aR,10bR)-3-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride (PubChem CID 45260521) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is (4aR,10bR)-3-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride.
| Compound Name | (4aR,10bR)-3-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 45260521 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | (4aR,10bR)-3-methyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline;hydrochloride |
| SMILES | CN1CC[C@H]2c3ccccc3CC[C@H]2C1.Cl |
| InChI | InChI=1S/C14H19N.ClH/c1-15-9-8-14-12(10-15)7-6-11-4-2-3-5-13(11)14;/h2-5,12,14H,6-10H2,1H3;1H/t12-,14+;/m0./s1 |
| InChIKey | LEFUFQVBGCZVEF-DSHXVJGRSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |