C12H14 — CID 156649341
1,2,2a,3,4,8b-hexahydrocyclobuta[a]naphthalene (PubChem CID 156649341) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 1,2,2a,3,4,8b-hexahydrocyclobuta[a]naphthalene.
| Compound Name | 1,2,2a,3,4,8b-hexahydrocyclobuta[a]naphthalene |
|---|---|
| PubChem CID | 156649341 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1,2,2a,3,4,8b-hexahydrocyclobuta[a]naphthalene |
| SMILES | c1ccc2c(c1)CCC1CCC21 |
| InChI | InChI=1S/C12H14/c1-2-4-11-9(3-1)5-6-10-7-8-12(10)11/h1-4,10,12H,5-8H2 |
| InChIKey | ZYGGZFPRWSZIDT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |