C14H18 — CID 134946753
(1S)-1-cyclopentyl-2,3-dihydro-1H-indene (PubChem CID 134946753) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is (1S)-1-cyclopentyl-2,3-dihydro-1H-indene.
| Compound Name | (1S)-1-cyclopentyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 134946753 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (1S)-1-cyclopentyl-2,3-dihydro-1H-indene |
| SMILES | c1ccc2c(c1)CC[C@H]2C1CCCC1 |
| InChI | InChI=1S/C14H18/c1-2-6-11(5-1)14-10-9-12-7-3-4-8-13(12)14/h3-4,7-8,11,14H,1-2,5-6,9-10H2/t14-/m0/s1 |
| InChIKey | CNLFRPUENYEQFS-AWEZNQCLSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |