C20H32 — CID 158506578
1-cyclopentyl-1,2,3,4-tetrahydronaphthalene;pentane (PubChem CID 158506578) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is 1-cyclopentyl-1,2,3,4-tetrahydronaphthalene;pentane.
| Compound Name | 1-cyclopentyl-1,2,3,4-tetrahydronaphthalene;pentane |
|---|---|
| PubChem CID | 158506578 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 1-cyclopentyl-1,2,3,4-tetrahydronaphthalene;pentane |
| SMILES | CCCCC.c1ccc2c(c1)CCCC2C1CCCC1 |
| InChI | InChI=1S/C15H20.C5H12/c1-2-7-12(6-1)15-11-5-9-13-8-3-4-10-14(13)15;1-3-5-4-2/h3-4,8,10,12,15H,1-2,5-7,9,11H2;3-5H2,1-2H3 |
| InChIKey | HKNOLLJSNPGKAS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |