C13H16 — CID 519137
2,3,4,4a,9,9a-hexahydro-1H-fluorene (PubChem CID 519137) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,3,4,4a,9,9a-hexahydro-1H-fluorene.
| Compound Name | 2,3,4,4a,9,9a-hexahydro-1H-fluorene |
|---|---|
| PubChem CID | 519137 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2,3,4,4a,9,9a-hexahydro-1H-fluorene |
| SMILES | c1ccc2c(c1)CC1CCCCC21 |
| InChI | InChI=1S/C13H16/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1,3,5,7,11,13H,2,4,6,8-9H2 |
| InChIKey | OSJFWOVKJZKBOA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |