C16H22 — CID 165374450
3-propan-2-yl-2,3,4,4a,9,9a-hexahydro-1H-fluorene (PubChem CID 165374450) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-propan-2-yl-2,3,4,4a,9,9a-hexahydro-1H-fluorene.
| Compound Name | 3-propan-2-yl-2,3,4,4a,9,9a-hexahydro-1H-fluorene |
|---|---|
| PubChem CID | 165374450 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 3-propan-2-yl-2,3,4,4a,9,9a-hexahydro-1H-fluorene |
| SMILES | CC(C)C1CCC2Cc3ccccc3C2C1 |
| InChI | InChI=1S/C16H22/c1-11(2)12-7-8-14-9-13-5-3-4-6-15(13)16(14)10-12/h3-6,11-12,14,16H,7-10H2,1-2H3 |
| InChIKey | HHBLWYZEWBNCQL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |