C14H20 — CID 91488349
1,2,3,3a,4,8b-hexahydrocyclopenta[a]indene;ethane (PubChem CID 91488349) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1,2,3,3a,4,8b-hexahydrocyclopenta[a]indene;ethane.
| Compound Name | 1,2,3,3a,4,8b-hexahydrocyclopenta[a]indene;ethane |
|---|---|
| PubChem CID | 91488349 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1,2,3,3a,4,8b-hexahydrocyclopenta[a]indene;ethane |
| SMILES | CC.c1ccc2c(c1)CC1CCCC21 |
| InChI | InChI=1S/C12H14.C2H6/c1-2-6-11-9(4-1)8-10-5-3-7-12(10)11;1-2/h1-2,4,6,10,12H,3,5,7-8H2;1-2H3 |
| InChIKey | APJCTWXOKZVKJV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |