C16H22ClNO4 — CID 139057110
(1R,9S,17R)-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6-triene perchlorate (PubChem CID 139057110) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is (1R,9S,17R)-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6-triene perchlorate.
| Compound Name | (1R,9S,17R)-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6-triene perchlorate |
|---|---|
| PubChem CID | 139057110 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (1R,9S,17R)-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6-triene perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc2c(c1)C[C@@H]1CCC[NH+]3CCC[C@H]2[C@@H]13 |
| InChI | InChI=1S/C16H21N.ClHO4/c1-2-7-14-12(5-1)11-13-6-3-9-17-10-4-8-15(14)16(13)17;2-1(3,4)5/h1-2,5,7,13,15-16H,3-4,6,8-11H2;(H,2,3,4,5)/t13-,15+,16+;/m0./s1 |
| InChIKey | JXDLSDXMVACBET-QALYCTJVSA-N |
| XLogP | -2.97 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |