C12H17ClN+ — CID 86625805
(4aR,9aR)-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridin-1-ium;hydrochloride (PubChem CID 86625805) has the molecular formula C12H17ClN+ and a molecular weight of 210.73 g/mol. Its IUPAC name is (4aR,9aR)-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridin-1-ium;hydrochloride.
| Compound Name | (4aR,9aR)-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridin-1-ium;hydrochloride |
|---|---|
| PubChem CID | 86625805 |
| Molecular Formula | C12H17ClN+ |
| Molecular Weight | 210.73 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (4aR,9aR)-2,3,4,4a,9,9a-hexahydro-1H-indeno[2,1-b]pyridin-1-ium;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)C[C@H]1[NH2+]CCC[C@H]21 |
| InChI | InChI=1S/C12H15N.ClH/c1-2-5-10-9(4-1)8-12-11(10)6-3-7-13-12;/h1-2,4-5,11-13H,3,6-8H2;1H/p+1/t11-,12-;/m1./s1 |
| InChIKey | DUQRDEZPCFQEJV-MNMPKAIFSA-O |
| XLogP | 1.47 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.73 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |