C9H8I2 — CID 18913557
1,2-diiodo-2,3-dihydro-1H-indene (PubChem CID 18913557) has the molecular formula C9H8I2 and a molecular weight of 369.97 g/mol. Its IUPAC name is 1,2-diiodo-2,3-dihydro-1H-indene.
| Compound Name | 1,2-diiodo-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 18913557 |
| Molecular Formula | C9H8I2 |
| Molecular Weight | 369.97 g/mol |
| Exact Mass | 369.87 |
| IUPAC Name | 1,2-diiodo-2,3-dihydro-1H-indene |
| SMILES | IC1Cc2ccccc2C1I |
| InChI | InChI=1S/C9H8I2/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9H,5H2 |
| InChIKey | OXOKPKDJEFACAH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.97 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|