C14H11I — CID 70258846
9-iodo-9,10-dihydroanthracene (PubChem CID 70258846) has the molecular formula C14H11I and a molecular weight of 306.15 g/mol. Its IUPAC name is 9-iodo-9,10-dihydroanthracene.
| Compound Name | 9-iodo-9,10-dihydroanthracene |
|---|---|
| PubChem CID | 70258846 |
| Molecular Formula | C14H11I |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 9-iodo-9,10-dihydroanthracene |
| SMILES | IC1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C14H11I/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
| InChIKey | VLEVLFYZJJXJPM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|