C16H12F2 — CID 59040472
(2S,4R)-3,3-difluorotetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene (PubChem CID 59040472) has the molecular formula C16H12F2 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2S,4R)-3,3-difluorotetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene.
| Compound Name | (2S,4R)-3,3-difluorotetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene |
|---|---|
| PubChem CID | 59040472 |
| Molecular Formula | C16H12F2 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2S,4R)-3,3-difluorotetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene |
| SMILES | FC1(F)[C@@H]2c3ccccc3Cc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C16H12F2/c17-16(18)14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15(14)16/h1-8,14-15H,9H2/t14-,15+ |
| InChIKey | MCEKPQIEQNCWKR-GASCZTMLSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |