C12H16O — CID 91072401
ethane;1-methyl-1,3-dihydroinden-2-one (PubChem CID 91072401) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;1-methyl-1,3-dihydroinden-2-one.
| Compound Name | ethane;1-methyl-1,3-dihydroinden-2-one |
|---|---|
| PubChem CID | 91072401 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | ethane;1-methyl-1,3-dihydroinden-2-one |
| SMILES | CC.CC1C(=O)Cc2ccccc21 |
| InChI | InChI=1S/C10H10O.C2H6/c1-7-9-5-3-2-4-8(9)6-10(7)11;1-2/h2-5,7H,6H2,1H3;1-2H3 |
| InChIKey | BRDFFXBDSRUDBF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |