C14H21NO — CID 90705389
3,5-dimethyl-2,5-dihydro-1H-3-benzazepin-4-one;ethane (PubChem CID 90705389) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 3,5-dimethyl-2,5-dihydro-1H-3-benzazepin-4-one;ethane.
| Compound Name | 3,5-dimethyl-2,5-dihydro-1H-3-benzazepin-4-one;ethane |
|---|---|
| PubChem CID | 90705389 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3,5-dimethyl-2,5-dihydro-1H-3-benzazepin-4-one;ethane |
| SMILES | CC.CC1C(=O)N(C)CCc2ccccc21 |
| InChI | InChI=1S/C12H15NO.C2H6/c1-9-11-6-4-3-5-10(11)7-8-13(2)12(9)14;1-2/h3-6,9H,7-8H2,1-2H3;1-2H3 |
| InChIKey | ZKBNTNRVWHJAHN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |