C14H23NO — CID 91447303
ethane;2-methyl-3,4-dihydroisoquinolin-1-one (PubChem CID 91447303) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is ethane;2-methyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | ethane;2-methyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 91447303 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | ethane;2-methyl-3,4-dihydroisoquinolin-1-one |
| SMILES | CC.CC.CN1CCc2ccccc2C1=O |
| InChI | InChI=1S/C10H11NO.2C2H6/c1-11-7-6-8-4-2-3-5-9(8)10(11)12;2*1-2/h2-5H,6-7H2,1H3;2*1-2H3 |
| InChIKey | AGFOQQDZNQTDEN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |